C13H24O3S — CID 123292360
S-[3-(3,3-dimethyl-4-oxobutoxy)-3-methylbutyl] ethanethioate (PubChem CID 123292360) has the molecular formula C13H24O3S and a molecular weight of 260.40 g/mol. Its IUPAC name is S-[3-(3,3-dimethyl-4-oxobutoxy)-3-methylbutyl] ethanethioate.
| Compound Name | S-[3-(3,3-dimethyl-4-oxobutoxy)-3-methylbutyl] ethanethioate |
|---|---|
| PubChem CID | 123292360 |
| Molecular Formula | C13H24O3S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | S-[3-(3,3-dimethyl-4-oxobutoxy)-3-methylbutyl] ethanethioate |
| SMILES | CC(=O)SCCC(C)(C)OCCC(C)(C)C=O |
| InChI | InChI=1S/C13H24O3S/c1-11(15)17-9-7-13(4,5)16-8-6-12(2,3)10-14/h10H,6-9H2,1-5H3 |
| InChIKey | YHWLZHKSLSOATM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|