C51H46 — CID 90774554
2-[4-[3-buta-1,3-dienyl-4-(3-phenyl-7,8-dihydronaphthalen-2-yl)-4a,8a-dihydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene (PubChem CID 90774554) has the molecular formula C51H46 and a molecular weight of 658.93 g/mol. Its IUPAC name is 2-[4-[3-buta-1,3-dienyl-4-(3-phenyl-7,8-dihydronaphthalen-2-yl)-4a,8a-dihydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene.
| Compound Name | 2-[4-[3-buta-1,3-dienyl-4-(3-phenyl-7,8-dihydronaphthalen-2-yl)-4a,8a-dihydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene |
|---|---|
| PubChem CID | 90774554 |
| Molecular Formula | C51H46 |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.36 |
| IUPAC Name | 2-[4-[3-buta-1,3-dienyl-4-(3-phenyl-7,8-dihydronaphthalen-2-yl)-4a,8a-dihydronaphthalen-1-yl]cyclohexa-1,3-dien-1-yl]-9,9-dimethyl-1,9a-dihydrofluorene |
| SMILES | C=CC=CC1=C(c2cc3c(cc2-c2ccccc2)C=CCC3)C2C=CC=CC2C(C2=CC=C(C3=CC=C4c5ccccc5C(C)(C)C4C3)CC2)=C1 |
| InChI | InChI=1S/C51H46/c1-4-5-15-40-32-45(36-26-24-34(25-27-36)39-28-29-43-42-21-13-14-23-48(42)51(2,3)49(43)33-39)41-20-11-12-22-44(41)50(40)47-31-38-19-10-9-18-37(38)30-46(47)35-16-7-6-8-17-35/h4-9,11-18,20-24,26,28-32,41,44,49H,1,10,19,25,27,33H2,2-3H3 |
| InChIKey | MAGCRGQTSVZBDB-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|