C75H74N2 — CID 145141140
CID 145141140 (PubChem CID 145141140) has the molecular formula C75H74N2 and a molecular weight of 1003.43 g/mol.
| Compound Name | CID 145141140 |
|---|---|
| PubChem CID | 145141140 |
| Molecular Formula | C75H74N2 |
| Molecular Weight | 1003.43 g/mol |
| Exact Mass | 1002.59 |
| IUPAC Name | — |
| SMILES | CC1(C)c2ccccc2C2=CC=C(C3=NC(C4CC=C(c5ccccc5)CC4)C=C(C4=CC=C(C5=CC6C(C=C5)c5ccccc5C65C6=C(CCC=C6)C6(C7=C(C=CCC7)C7CCC=CC76)C6CCC=CC65)CC4)N3)CC21 |
| InChI | InChI=1S/C75H74N2/c1-73(2)60-24-10-6-20-54(60)58-43-41-53(45-68(58)73)72-76-70(50-36-32-48(33-37-50)47-18-4-3-5-19-47)46-71(77-72)51-38-34-49(35-39-51)52-40-42-59-57-23-9-13-27-63(57)75(69(59)44-52)66-30-16-14-28-64(66)74(65-29-15-17-31-67(65)75)61-25-11-7-21-55(61)56-22-8-12-26-62(56)74/h3-7,9-10,12-13,16-21,23-24,26-27,30-32,34,38,40-44,46,50,56,59,62,64,66,68-70H,8,11,14-15,22,25,28-29,33,35-37,39,45H2,1-2H3,(H,76,77) |
| InChIKey | SIJDYSBTCROQTD-UHFFFAOYSA-N |
| XLogP | 17.71 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1003.43 |
| LogP ≤ 5 | 17.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|