C60H52N2 — CID 145141180
CID 145141180 (PubChem CID 145141180) has the molecular formula C60H52N2 and a molecular weight of 801.09 g/mol.
| Compound Name | CID 145141180 |
|---|---|
| PubChem CID | 145141180 |
| Molecular Formula | C60H52N2 |
| Molecular Weight | 801.09 g/mol |
| Exact Mass | 800.41 |
| IUPAC Name | — |
| SMILES | C1=CCCC(C2=CCC(C3=NC(c4ccccc4)C=C(C4=CC5C(C=C4)c4ccccc4C54C5=C(CCC=C5)C5(C6=C4CCC=C6)c4ccccc4C4C=CC=CC45)N3)C=C2)=C1 |
| InChI | InChI=1S/C60H52N2/c1-3-17-39(18-4-1)40-31-33-42(34-32-40)58-61-56(41-19-5-2-6-20-41)38-57(62-58)43-35-36-47-46-23-9-12-26-50(46)60(55(47)37-43)53-29-15-13-27-51(53)59(52-28-14-16-30-54(52)60)48-24-10-7-21-44(48)45-22-8-11-25-49(45)59/h1-3,5-13,16-17,19-27,30-33,35-38,42,44,47-48,55-56H,4,14-15,18,28-29,34H2,(H,61,62) |
| InChIKey | ICFIEGVBDPNHLI-UHFFFAOYSA-N |
| XLogP | 13.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.09 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |