C52H44N2 — CID 139525846
2-[3-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]phenyl]-4-cyclohexa-1,3-dien-1-yl-5,6-di(cyclohexa-1,5-dien-1-yl)-1,2-dihydropyrimidine (PubChem CID 139525846) has the molecular formula C52H44N2 and a molecular weight of 696.94 g/mol. Its IUPAC name is 2-[3-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]phenyl]-4-cyclohexa-1,3-dien-1-yl-5,6-di(cyclohexa-1,5-dien-1-yl)-1,2-dihydropyrimidine.
| Compound Name | 2-[3-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]phenyl]-4-cyclohexa-1,3-dien-1-yl-5,6-di(cyclohexa-1,5-dien-1-yl)-1,2-dihydropyrimidine |
|---|---|
| PubChem CID | 139525846 |
| Molecular Formula | C52H44N2 |
| Molecular Weight | 696.94 g/mol |
| Exact Mass | 696.35 |
| IUPAC Name | 2-[3-[3-(4b,8a-dihydrotriphenylen-2-yl)phenyl]phenyl]-4-cyclohexa-1,3-dien-1-yl-5,6-di(cyclohexa-1,5-dien-1-yl)-1,2-dihydropyrimidine |
| SMILES | C1=CCCC(C2=NC(c3cccc(-c4cccc(-c5ccc6c(c5)-c5ccccc5C5C=CC=CC65)c4)c3)NC(C3=CCCC=C3)=C2C2=CCCC=C2)=C1 |
| InChI | InChI=1S/C52H44N2/c1-4-16-35(17-5-1)49-50(36-18-6-2-7-19-36)53-52(54-51(49)37-20-8-3-9-21-37)42-25-15-24-40(33-42)38-22-14-23-39(32-38)41-30-31-47-45-28-11-10-26-43(45)44-27-12-13-29-46(44)48(47)34-41/h2,4,6,8,10-18,20-34,43,45,52,54H,1,3,5,7,9,19H2 |
| InChIKey | YZXGMDSXELDEQM-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.94 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |