C18H21F4NO5S — CID 90774955
(2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 90774955) has the molecular formula C18H21F4NO5S and a molecular weight of 439.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 90774955 |
| Molecular Formula | C18H21F4NO5S |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)C(F)(F)C1CC2CC1C1C3CCC(C3)C21 |
| InChI | InChI=1S/C18H21F4NO5S/c19-17(20,18(21,22)29(26,27)28-23-13(24)3-4-14(23)25)12-7-10-6-11(12)16-9-2-1-8(5-9)15(10)16/h3-4,8-12,15-16,24-25H,1-2,5-7H2 |
| InChIKey | USEBTUIJMLZUCH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|