C13H15F4NO5S — CID 90800471
(2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 90800471) has the molecular formula C13H15F4NO5S and a molecular weight of 373.32 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 90800471 |
| Molecular Formula | C13H15F4NO5S |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-(2-bicyclo[2.2.1]heptanyl)-1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)C(F)(F)C1CC2CCC1C2 |
| InChI | InChI=1S/C13H15F4NO5S/c14-12(15,9-6-7-1-2-8(9)5-7)13(16,17)24(21,22)23-18-10(19)3-4-11(18)20/h3-4,7-9,19-20H,1-2,5-6H2 |
| InChIKey | DSINQJISPGMPPX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|