C13H15F4NO6S — CID 91144629
(2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate (PubChem CID 91144629) has the molecular formula C13H15F4NO6S and a molecular weight of 389.32 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
|---|---|
| PubChem CID | 91144629 |
| Molecular Formula | C13H15F4NO6S |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(5-hydroxy-2-bicyclo[2.2.1]heptanyl)ethanesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)C(F)(F)C1CC2CC1CC2O |
| InChI | InChI=1S/C13H15F4NO6S/c14-12(15,8-4-7-3-6(8)5-9(7)19)13(16,17)25(22,23)24-18-10(20)1-2-11(18)21/h1-2,6-9,19-21H,3-5H2 |
| InChIKey | DBYWBMHHQVQYKQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|