C18H21F4NO6S — CID 91394827
(2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate (PubChem CID 91394827) has the molecular formula C18H21F4NO6S and a molecular weight of 455.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
|---|---|
| PubChem CID | 91394827 |
| Molecular Formula | C18H21F4NO6S |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 1,1,2,2-tetrafluoro-2-(10-hydroxy-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl)ethanesulfonate |
| SMILES | O=S(=O)(On1c(O)ccc1O)C(F)(F)C(F)(F)C1CC2CC1C1C3CC(CC3O)C21 |
| InChI | InChI=1S/C18H21F4NO6S/c19-17(20,18(21,22)30(27,28)29-23-13(25)1-2-14(23)26)11-5-7-3-9(11)16-10-4-8(15(7)16)6-12(10)24/h1-2,7-12,15-16,24-26H,3-6H2 |
| InChIKey | CWBUQASVLYLARA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|