C13H11BrN4O3 — CID 9077503
5-bromo-N'-[2-(2-oxo-1-pyridinyl)acetyl]pyridine-3-carbohydrazide (PubChem CID 9077503) has the molecular formula C13H11BrN4O3 and a molecular weight of 351.16 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2-oxo-1-pyridinyl)acetyl]pyridine-3-carbohydrazide.
| Compound Name | 5-bromo-N'-[2-(2-oxo-1-pyridinyl)acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 9077503 |
| Molecular Formula | C13H11BrN4O3 |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 5-bromo-N'-[2-(2-oxo-1-pyridinyl)acetyl]pyridine-3-carbohydrazide |
| SMILES | O=C(Cn1ccccc1=O)NNC(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C13H11BrN4O3/c14-10-5-9(6-15-7-10)13(21)17-16-11(19)8-18-4-2-1-3-12(18)20/h1-7H,8H2,(H,16,19)(H,17,21) |
| InChIKey | RVMCHNMANROTRA-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|