C38H50N2O9 — CID 90779330
diethyl (1R,3'R)-3'-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-6,7-dimethoxy-2-prop-2-enoylspiro[3,4-dihydroisoquinoline-1,4'-cyclohexane]-1',1'-dicarboxylate (PubChem CID 90779330) has the molecular formula C38H50N2O9 and a molecular weight of 678.82 g/mol. Its IUPAC name is diethyl (1R,3'R)-3'-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-6,7-dimethoxy-2-prop-2-enoylspiro[3,4-dihydroisoquinoline-1,4'-cyclohexane]-1',1'-dicarboxylate.
| Compound Name | diethyl (1R,3'R)-3'-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-6,7-dimethoxy-2-prop-2-enoylspiro[3,4-dihydroisoquinoline-1,4'-cyclohexane]-1',1'-dicarboxylate |
|---|---|
| PubChem CID | 90779330 |
| Molecular Formula | C38H50N2O9 |
| Molecular Weight | 678.82 g/mol |
| Exact Mass | 678.35 |
| IUPAC Name | diethyl (1R,3'R)-3'-(2-ethyl-6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-1-yl)-6,7-dimethoxy-2-prop-2-enoylspiro[3,4-dihydroisoquinoline-1,4'-cyclohexane]-1',1'-dicarboxylate |
| SMILES | C=CC(=O)N1CCc2cc(OC)c(OC)cc2[C@]12CCC(C(=O)OCC)(C(=O)OCC)C[C@@H]2C1c2cc(OC)c(OC)cc2CCN1CC |
| InChI | InChI=1S/C38H50N2O9/c1-9-33(41)40-18-14-25-20-30(45-6)32(47-8)22-27(25)38(40)16-15-37(35(42)48-11-3,36(43)49-12-4)23-28(38)34-26-21-31(46-7)29(44-5)19-24(26)13-17-39(34)10-2/h9,19-22,28,34H,1,10-18,23H2,2-8H3/t28-,34?,38+/m1/s1 |
| InChIKey | YBHVRKQCQIJFFM-PKEGQARDSA-N |
| XLogP | 5.02 |
| TPSA | 113.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.82 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|