C44H24F8N4 — CID 90781202
5,10,15,20-tetrakis(3,5-difluorophenyl)-21,22,23,24-tetrahydroporphyrin (PubChem CID 90781202) has the molecular formula C44H24F8N4 and a molecular weight of 760.69 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,5-difluorophenyl)-21,22,23,24-tetrahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3,5-difluorophenyl)-21,22,23,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 90781202 |
| Molecular Formula | C44H24F8N4 |
| Molecular Weight | 760.69 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 5,10,15,20-tetrakis(3,5-difluorophenyl)-21,22,23,24-tetrahydroporphyrin |
| SMILES | Fc1cc(F)cc(C2=c3ccc([nH]3)=C(c3cc(F)cc(F)c3)c3ccc([nH]3)C(c3cc(F)cc(F)c3)=c3ccc([nH]3)=C(c3cc(F)cc(F)c3)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C44H24F8N4/c45-25-9-21(10-26(46)17-25)41-33-1-2-34(53-33)42(22-11-27(47)18-28(48)12-22)36-5-6-38(55-36)44(24-15-31(51)20-32(52)16-24)40-8-7-39(56-40)43(37-4-3-35(41)54-37)23-13-29(49)19-30(50)14-23/h1-20,53-56H |
| InChIKey | ASLOZPXNXOBITE-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.69 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 0 |