C28H32Cl2N2O3 — CID 90781439
3-amino-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-(2-phenylethyl)butanamide (PubChem CID 90781439) has the molecular formula C28H32Cl2N2O3 and a molecular weight of 515.48 g/mol. Its IUPAC name is 3-amino-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-(2-phenylethyl)butanamide.
| Compound Name | 3-amino-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 90781439 |
| Molecular Formula | C28H32Cl2N2O3 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 3-amino-2-[[4-[2-(2,6-dichloro-4-methylphenoxy)ethoxy]phenyl]methyl]-N-(2-phenylethyl)butanamide |
| SMILES | Cc1cc(Cl)c(OCCOc2ccc(CC(C(=O)NCCc3ccccc3)C(C)N)cc2)c(Cl)c1 |
| InChI | InChI=1S/C28H32Cl2N2O3/c1-19-16-25(29)27(26(30)17-19)35-15-14-34-23-10-8-22(9-11-23)18-24(20(2)31)28(33)32-13-12-21-6-4-3-5-7-21/h3-11,16-17,20,24H,12-15,18,31H2,1-2H3,(H,32,33) |
| InChIKey | GFXZNKXFPFXLMB-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|