C10H11IN4O3 — CID 90781807
(2R,3S)-2-(hydroxymethyl)-5-(2-iodopurin-1-yl)oxolan-3-ol (PubChem CID 90781807) has the molecular formula C10H11IN4O3 and a molecular weight of 362.13 g/mol. Its IUPAC name is (2R,3S)-2-(hydroxymethyl)-5-(2-iodopurin-1-yl)oxolan-3-ol.
| Compound Name | (2R,3S)-2-(hydroxymethyl)-5-(2-iodopurin-1-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 90781807 |
| Molecular Formula | C10H11IN4O3 |
| Molecular Weight | 362.13 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | (2R,3S)-2-(hydroxymethyl)-5-(2-iodopurin-1-yl)oxolan-3-ol |
| SMILES | OC[C@H]1OC(n2cc3ncnc-3nc2I)C[C@@H]1O |
| InChI | InChI=1S/C10H11IN4O3/c11-10-14-9-5(12-4-13-9)2-15(10)8-1-6(17)7(3-16)18-8/h2,4,6-8,16-17H,1,3H2/t6-,7+,8?/m0/s1 |
| InChIKey | MGCUMJJZJSXHTG-KJFJCRTCSA-N |
| XLogP | 0.02 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.13 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|