C16H22N4O3S2 — CID 9078212
N-[(Z)-[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]-4-ethoxybenzenesulfonamide (PubChem CID 9078212) has the molecular formula C16H22N4O3S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-[(Z)-[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]-4-ethoxybenzenesulfonamide.
| Compound Name | N-[(Z)-[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 9078212 |
| Molecular Formula | C16H22N4O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | N-[(Z)-[2-(diethylamino)-1,3-thiazol-5-yl]methylideneamino]-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)N/N=C\c2cnc(N(CC)CC)s2)cc1 |
| InChI | InChI=1S/C16H22N4O3S2/c1-4-20(5-2)16-17-11-14(24-16)12-18-19-25(21,22)15-9-7-13(8-10-15)23-6-3/h7-12,19H,4-6H2,1-3H3/b18-12- |
| InChIKey | IQOGCSQJNOTXRA-PDGQHHTCSA-N |
| XLogP | 2.70 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|