C23H26FN7O3 — CID 90782133
4-[N-cyano-N-(2-methyl-3-nitrophenyl)carbamimidoyl]-N-(3-fluorophenyl)-3-propan-2-ylpiperazine-1-carboxamide (PubChem CID 90782133) has the molecular formula C23H26FN7O3 and a molecular weight of 467.51 g/mol. Its IUPAC name is 4-[N-cyano-N-(2-methyl-3-nitrophenyl)carbamimidoyl]-N-(3-fluorophenyl)-3-propan-2-ylpiperazine-1-carboxamide.
| Compound Name | 4-[N-cyano-N-(2-methyl-3-nitrophenyl)carbamimidoyl]-N-(3-fluorophenyl)-3-propan-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 90782133 |
| Molecular Formula | C23H26FN7O3 |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | 4-[N-cyano-N-(2-methyl-3-nitrophenyl)carbamimidoyl]-N-(3-fluorophenyl)-3-propan-2-ylpiperazine-1-carboxamide |
| SMILES | [H]/N=C(\N(C#N)c1cccc([N+](=O)[O-])c1C)N1CCN(C(=O)Nc2cccc(F)c2)CC1C(C)C |
| InChI | InChI=1S/C23H26FN7O3/c1-15(2)21-13-28(23(32)27-18-7-4-6-17(24)12-18)10-11-29(21)22(26)30(14-25)19-8-5-9-20(16(19)3)31(33)34/h4-9,12,15,21,26H,10-11,13H2,1-3H3,(H,27,32)/b26-22- |
| InChIKey | BCFOGFZJKZLFOZ-ROMGYVFFSA-N |
| XLogP | 4.14 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|