C19H36O — CID 90787363
(2R,3S)-2-dec-9-enyl-3-(5-methylhexyl)oxirane (PubChem CID 90787363) has the molecular formula C19H36O and a molecular weight of 280.50 g/mol. Its IUPAC name is (2R,3S)-2-dec-9-enyl-3-(5-methylhexyl)oxirane.
| Compound Name | (2R,3S)-2-dec-9-enyl-3-(5-methylhexyl)oxirane |
|---|---|
| PubChem CID | 90787363 |
| Molecular Formula | C19H36O |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.28 |
| IUPAC Name | (2R,3S)-2-dec-9-enyl-3-(5-methylhexyl)oxirane |
| SMILES | C=CCCCCCCCC[C@H]1O[C@H]1CCCCC(C)C |
| InChI | InChI=1S/C19H36O/c1-4-5-6-7-8-9-10-11-15-18-19(20-18)16-13-12-14-17(2)3/h4,17-19H,1,5-16H2,2-3H3/t18-,19+/m1/s1 |
| InChIKey | VEHBXHNRALNERE-MOPGFXCFSA-N |
| XLogP | 6.28 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|