C16H31N5O2 — CID 90787696
tert-butyl N-[3-[ethyl-[1-(2H-imidazol-4-ylamino)ethyl]amino]propyl]-N-methylcarbamate (PubChem CID 90787696) has the molecular formula C16H31N5O2 and a molecular weight of 325.46 g/mol. Its IUPAC name is tert-butyl N-[3-[ethyl-[1-(2H-imidazol-4-ylamino)ethyl]amino]propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[ethyl-[1-(2H-imidazol-4-ylamino)ethyl]amino]propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 90787696 |
| Molecular Formula | C16H31N5O2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.25 |
| IUPAC Name | tert-butyl N-[3-[ethyl-[1-(2H-imidazol-4-ylamino)ethyl]amino]propyl]-N-methylcarbamate |
| SMILES | CCN(CCCN(C)C(=O)OC(C)(C)C)C(C)NC1=NCN=C1 |
| InChI | InChI=1S/C16H31N5O2/c1-7-21(13(2)19-14-11-17-12-18-14)10-8-9-20(6)15(22)23-16(3,4)5/h11,13H,7-10,12H2,1-6H3,(H,18,19) |
| InChIKey | LZSGMHMKQCCHJI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|