C13H26N4O2 — CID 110915009
tert-butyl N-methyl-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate (PubChem CID 110915009) has the molecular formula C13H26N4O2 and a molecular weight of 270.38 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate |
|---|---|
| PubChem CID | 110915009 |
| Molecular Formula | C13H26N4O2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | tert-butyl N-methyl-N-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]carbamate |
| SMILES | CN(CCCNC1=NCCCN1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H26N4O2/c1-13(2,3)19-12(18)17(4)10-6-9-16-11-14-7-5-8-15-11/h5-10H2,1-4H3,(H2,14,15,16) |
| InChIKey | ZWJYUJZFPIVIIT-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|