C20H34O6 — CID 90792530
ethyl 2-(3,5-dimethoxycyclohexylidene)acetate;(5S)-3-methoxy-5-methylcyclohexan-1-one (PubChem CID 90792530) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is ethyl 2-(3,5-dimethoxycyclohexylidene)acetate;(5S)-3-methoxy-5-methylcyclohexan-1-one.
| Compound Name | ethyl 2-(3,5-dimethoxycyclohexylidene)acetate;(5S)-3-methoxy-5-methylcyclohexan-1-one |
|---|---|
| PubChem CID | 90792530 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | ethyl 2-(3,5-dimethoxycyclohexylidene)acetate;(5S)-3-methoxy-5-methylcyclohexan-1-one |
| SMILES | CCOC(=O)C=C1CC(OC)CC(OC)C1.COC1CC(=O)C[C@@H](C)C1 |
| InChI | InChI=1S/C12H20O4.C8H14O2/c1-4-16-12(13)7-9-5-10(14-2)8-11(6-9)15-3;1-6-3-7(9)5-8(4-6)10-2/h7,10-11H,4-6,8H2,1-3H3;6,8H,3-5H2,1-2H3/t;6-,8?/m.1/s1 |
| InChIKey | OFODXNVCQWWYCJ-XKXZNDPJSA-N |
| XLogP | 3.08 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|