C23H31FO4 — CID 90793498
[(8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-3,17-dihydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 90793498) has the molecular formula C23H31FO4 and a molecular weight of 390.50 g/mol. Its IUPAC name is [(8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-3,17-dihydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-3,17-dihydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 90793498 |
| Molecular Formula | C23H31FO4 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | [(8R,9R,10R,13S,14S)-4-(2-fluoroethynyl)-3,17-dihydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)OC1C[C@H]2[C@@H]3CCC4=C(C#CF)C(O)CC[C@]4(C)[C@@H]3CC[C@]2(C)C1O |
| InChI | InChI=1S/C23H31FO4/c1-13(25)28-20-12-18-14-4-5-16-15(8-11-24)19(26)7-10-22(16,2)17(14)6-9-23(18,3)21(20)27/h14,17-21,26-27H,4-7,9-10,12H2,1-3H3/t14-,17-,18+,19?,20?,21?,22+,23+/m1/s1 |
| InChIKey | DACHZWIGPGISDX-OIMGVSBSSA-N |
| XLogP | 3.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|