C22H27FO5 — CID 15125814
[(8S,9S,10S,13S,14S,16R,17R)-17-acetyloxy-10-fluoro-13-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl] acetate (PubChem CID 15125814) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,16R,17R)-17-acetyloxy-10-fluoro-13-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl] acetate.
| Compound Name | [(8S,9S,10S,13S,14S,16R,17R)-17-acetyloxy-10-fluoro-13-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl] acetate |
|---|---|
| PubChem CID | 15125814 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | [(8S,9S,10S,13S,14S,16R,17R)-17-acetyloxy-10-fluoro-13-methyl-3-oxo-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-16-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(F)[C@H]3CC[C@]2(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C22H27FO5/c1-12(24)27-19-11-18-16-5-4-14-10-15(26)6-9-22(14,23)17(16)7-8-21(18,3)20(19)28-13(2)25/h6,9-10,16-20H,4-5,7-8,11H2,1-3H3/t16-,17+,18+,19-,20+,21+,22-/m1/s1 |
| InChIKey | LLLHUBXXXZKPEH-ZOSSLFJCSA-N |
| XLogP | 3.47 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |