C21H22ClN3O3 — CID 90795983
3-[[3-[(2-chlorophenyl)methylamino]-7-methoxy-1,2-dihydroindeno[1,2-c]pyrazol-6-yl]oxy]propan-1-ol (PubChem CID 90795983) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 3-[[3-[(2-chlorophenyl)methylamino]-7-methoxy-1,2-dihydroindeno[1,2-c]pyrazol-6-yl]oxy]propan-1-ol.
| Compound Name | 3-[[3-[(2-chlorophenyl)methylamino]-7-methoxy-1,2-dihydroindeno[1,2-c]pyrazol-6-yl]oxy]propan-1-ol |
|---|---|
| PubChem CID | 90795983 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 3-[[3-[(2-chlorophenyl)methylamino]-7-methoxy-1,2-dihydroindeno[1,2-c]pyrazol-6-yl]oxy]propan-1-ol |
| SMILES | COc1cc2c3[nH][nH]c(NCc4ccccc4Cl)c-3cc2cc1OCCCO |
| InChI | InChI=1S/C21H22ClN3O3/c1-27-18-11-15-14(10-19(18)28-8-4-7-26)9-16-20(15)24-25-21(16)23-12-13-5-2-3-6-17(13)22/h2-3,5-6,9-11,23-26H,4,7-8,12H2,1H3 |
| InChIKey | QZBAFHAMEZRVPH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 82.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|