C24H20IN3O2 — CID 90990929
N-(3-iodophenyl)-7-methoxy-6-phenylmethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-amine (PubChem CID 90990929) has the molecular formula C24H20IN3O2 and a molecular weight of 509.35 g/mol. Its IUPAC name is N-(3-iodophenyl)-7-methoxy-6-phenylmethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-amine.
| Compound Name | N-(3-iodophenyl)-7-methoxy-6-phenylmethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-amine |
|---|---|
| PubChem CID | 90990929 |
| Molecular Formula | C24H20IN3O2 |
| Molecular Weight | 509.35 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | N-(3-iodophenyl)-7-methoxy-6-phenylmethoxy-1,2-dihydroindeno[1,2-c]pyrazol-3-amine |
| SMILES | COc1cc2c3[nH][nH]c(Nc4cccc(I)c4)c-3cc2cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H20IN3O2/c1-29-21-13-19-16(11-22(21)30-14-15-6-3-2-4-7-15)10-20-23(19)27-28-24(20)26-18-9-5-8-17(25)12-18/h2-13,26-28H,14H2,1H3 |
| InChIKey | NHLQSDWBGVLGFE-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 62.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.35 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|