C24H23N3O2 — CID 90798525
(4R)-4-(4-ethylphenyl)-2-phenyl-1,4,4a,6,7,8-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 90798525) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (4R)-4-(4-ethylphenyl)-2-phenyl-1,4,4a,6,7,8-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4R)-4-(4-ethylphenyl)-2-phenyl-1,4,4a,6,7,8-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 90798525 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (4R)-4-(4-ethylphenyl)-2-phenyl-1,4,4a,6,7,8-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | CCc1ccc([C@@H]2c3c([nH]n(-c4ccccc4)c3=O)N=C3CCCC(=O)C32)cc1 |
| InChI | InChI=1S/C24H23N3O2/c1-2-15-11-13-16(14-12-15)20-21-18(9-6-10-19(21)28)25-23-22(20)24(29)27(26-23)17-7-4-3-5-8-17/h3-5,7-8,11-14,20-21,26H,2,6,9-10H2,1H3/t20-,21?/m0/s1 |
| InChIKey | YDGWWHHVZUHUKO-BGERDNNASA-N |
| XLogP | 4.32 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |