C22H18ClN3O2 — CID 2208426
(4S,4aR)-4-(4-chlorophenyl)-2-phenyl-1,4,4a,6,7,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 2208426) has the molecular formula C22H18ClN3O2 and a molecular weight of 391.86 g/mol. Its IUPAC name is (4S,4aR)-4-(4-chlorophenyl)-2-phenyl-1,4,4a,6,7,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4S,4aR)-4-(4-chlorophenyl)-2-phenyl-1,4,4a,6,7,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 2208426 |
| Molecular Formula | C22H18ClN3O2 |
| Molecular Weight | 391.86 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (4S,4aR)-4-(4-chlorophenyl)-2-phenyl-1,4,4a,6,7,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | O=C1CCC=C2Nc3[nH]n(-c4ccccc4)c(=O)c3[C@H](c3ccc(Cl)cc3)[C@@H]12 |
| InChI | InChI=1S/C22H18ClN3O2/c23-14-11-9-13(10-12-14)18-19-16(7-4-8-17(19)27)24-21-20(18)22(28)26(25-21)15-5-2-1-3-6-15/h1-3,5-7,9-12,18-19,24-25H,4,8H2/t18-,19-/m1/s1 |
| InChIKey | MIEKLSXTWAYPJH-RTBURBONSA-N |
| XLogP | 4.24 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |