C25H20N4O2S — CID 135748907
4-[(5S,5aR)-2-benzylsulfanyl-4,6-dioxo-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzonitrile (PubChem CID 135748907) has the molecular formula C25H20N4O2S and a molecular weight of 440.53 g/mol. Its IUPAC name is 4-[(5S,5aR)-2-benzylsulfanyl-4,6-dioxo-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzonitrile.
| Compound Name | 4-[(5S,5aR)-2-benzylsulfanyl-4,6-dioxo-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzonitrile |
|---|---|
| PubChem CID | 135748907 |
| Molecular Formula | C25H20N4O2S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 4-[(5S,5aR)-2-benzylsulfanyl-4,6-dioxo-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinolin-5-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@H]2c3c(nc(SCc4ccccc4)[nH]c3=O)NC3=CCCC(=O)[C@@H]32)cc1 |
| InChI | InChI=1S/C25H20N4O2S/c26-13-15-9-11-17(12-10-15)20-21-18(7-4-8-19(21)30)27-23-22(20)24(31)29-25(28-23)32-14-16-5-2-1-3-6-16/h1-3,5-7,9-12,20-21H,4,8,14H2,(H2,27,28,29,31)/t20-,21-/m1/s1 |
| InChIKey | FZXBYJZDCWNJPP-NHCUHLMSSA-N |
| XLogP | 4.35 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |