C23H22N4OS — CID 2034941
(8aS,9R)-2-benzylsulfanyl-9-(4-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2034941) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is (8aS,9R)-2-benzylsulfanyl-9-(4-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (8aS,9R)-2-benzylsulfanyl-9-(4-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2034941 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (8aS,9R)-2-benzylsulfanyl-9-(4-methylphenyl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | Cc1ccc([C@H]2[C@@H]3C(=O)CCC=C3Nc3nc(SCc4ccccc4)nn32)cc1 |
| InChI | InChI=1S/C23H22N4OS/c1-15-10-12-17(13-11-15)21-20-18(8-5-9-19(20)28)24-22-25-23(26-27(21)22)29-14-16-6-3-2-4-7-16/h2-4,6-8,10-13,20-21H,5,9,14H2,1H3,(H,24,25,26)/t20-,21-/m0/s1 |
| InChIKey | ISIKFKNLCZEEIT-SFTDATJTSA-N |
| XLogP | 4.76 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |