C15H15N5O4S — CID 2034973
(8aR,9S)-2-ethylsulfanyl-9-(5-nitrofuran-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2034973) has the molecular formula C15H15N5O4S and a molecular weight of 361.38 g/mol. Its IUPAC name is (8aR,9S)-2-ethylsulfanyl-9-(5-nitrofuran-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (8aR,9S)-2-ethylsulfanyl-9-(5-nitrofuran-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2034973 |
| Molecular Formula | C15H15N5O4S |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (8aR,9S)-2-ethylsulfanyl-9-(5-nitrofuran-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CCSc1nc2n(n1)[C@H](c1ccc([N+](=O)[O-])o1)[C@H]1C(=O)CCC=C1N2 |
| InChI | InChI=1S/C15H15N5O4S/c1-2-25-15-17-14-16-8-4-3-5-9(21)12(8)13(19(14)18-15)10-6-7-11(24-10)20(22)23/h4,6-7,12-13H,2-3,5H2,1H3,(H,16,17,18)/t12-,13-/m1/s1 |
| InChIKey | MBCWNBGRXMNVJR-CHWSQXEVSA-N |
| XLogP | 2.77 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|