C22H19FN4OS — CID 2153559
(8aR,9S)-2-[(2-fluorophenyl)methylsulfanyl]-9-phenyl-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2153559) has the molecular formula C22H19FN4OS and a molecular weight of 406.49 g/mol. Its IUPAC name is (8aR,9S)-2-[(2-fluorophenyl)methylsulfanyl]-9-phenyl-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (8aR,9S)-2-[(2-fluorophenyl)methylsulfanyl]-9-phenyl-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2153559 |
| Molecular Formula | C22H19FN4OS |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | (8aR,9S)-2-[(2-fluorophenyl)methylsulfanyl]-9-phenyl-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CCC=C2Nc3nc(SCc4ccccc4F)nn3[C@H](c3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C22H19FN4OS/c23-16-10-5-4-9-15(16)13-29-22-25-21-24-17-11-6-12-18(28)19(17)20(27(21)26-22)14-7-2-1-3-8-14/h1-5,7-11,19-20H,6,12-13H2,(H,24,25,26)/t19-,20-/m1/s1 |
| InChIKey | TZABHPIBKKFAEY-WOJBJXKFSA-N |
| XLogP | 4.59 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |