C15H16N4OS2 — CID 2035632
(8aS,9R)-2-methylsulfanyl-9-(3-methylthiophen-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 2035632) has the molecular formula C15H16N4OS2 and a molecular weight of 332.45 g/mol. Its IUPAC name is (8aS,9R)-2-methylsulfanyl-9-(3-methylthiophen-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | (8aS,9R)-2-methylsulfanyl-9-(3-methylthiophen-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 2035632 |
| Molecular Formula | C15H16N4OS2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (8aS,9R)-2-methylsulfanyl-9-(3-methylthiophen-2-yl)-6,7,8a,9-tetrahydro-4H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | CSc1nc2n(n1)[C@@H](c1sccc1C)[C@@H]1C(=O)CCC=C1N2 |
| InChI | InChI=1S/C15H16N4OS2/c1-8-6-7-22-13(8)12-11-9(4-3-5-10(11)20)16-14-17-15(21-2)18-19(12)14/h4,6-7,11-12H,3,5H2,1-2H3,(H,16,17,18)/t11-,12+/m0/s1 |
| InChIKey | PRLRHICLECPLPG-NWDGAFQWSA-N |
| XLogP | 3.25 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |