C22H19N3O2S2 — CID 135833829
(5R,5aR)-2-benzylsulfanyl-5-thiophen-2-yl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135833829) has the molecular formula C22H19N3O2S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (5R,5aR)-2-benzylsulfanyl-5-thiophen-2-yl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R,5aR)-2-benzylsulfanyl-5-thiophen-2-yl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135833829 |
| Molecular Formula | C22H19N3O2S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (5R,5aR)-2-benzylsulfanyl-5-thiophen-2-yl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCC=C2Nc3nc(SCc4ccccc4)[nH]c(=O)c3[C@H](c3cccs3)[C@@H]12 |
| InChI | InChI=1S/C22H19N3O2S2/c26-15-9-4-8-14-17(15)18(16-10-5-11-28-16)19-20(23-14)24-22(25-21(19)27)29-12-13-6-2-1-3-7-13/h1-3,5-8,10-11,17-18H,4,9,12H2,(H2,23,24,25,27)/t17-,18-/m1/s1 |
| InChIKey | JEEVHIPXTVTLEQ-QZTJIDSGSA-N |
| XLogP | 4.54 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |