C18H16FN3O2S — CID 135833823
(5S,5aR)-5-(3-fluorophenyl)-2-methylsulfanyl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135833823) has the molecular formula C18H16FN3O2S and a molecular weight of 357.41 g/mol. Its IUPAC name is (5S,5aR)-5-(3-fluorophenyl)-2-methylsulfanyl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5S,5aR)-5-(3-fluorophenyl)-2-methylsulfanyl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135833823 |
| Molecular Formula | C18H16FN3O2S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (5S,5aR)-5-(3-fluorophenyl)-2-methylsulfanyl-3,5,5a,7,8,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CSc1nc2c(c(=O)[nH]1)[C@H](c1cccc(F)c1)[C@H]1C(=O)CCC=C1N2 |
| InChI | InChI=1S/C18H16FN3O2S/c1-25-18-21-16-15(17(24)22-18)13(9-4-2-5-10(19)8-9)14-11(20-16)6-3-7-12(14)23/h2,4-6,8,13-14H,3,7H2,1H3,(H2,20,21,22,24)/t13-,14-/m1/s1 |
| InChIKey | IECLNDUXFKKBDO-ZIAGYGMSSA-N |
| XLogP | 3.05 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |