C19H21N4O2S+ — CID 135533412
8,8-dimethyl-2-methylsulfanyl-5-pyridin-1-ium-3-yl-5,5a,7,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135533412) has the molecular formula C19H21N4O2S+ and a molecular weight of 369.47 g/mol. Its IUPAC name is 8,8-dimethyl-2-methylsulfanyl-5-pyridin-1-ium-3-yl-5,5a,7,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 8,8-dimethyl-2-methylsulfanyl-5-pyridin-1-ium-3-yl-5,5a,7,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135533412 |
| Molecular Formula | C19H21N4O2S+ |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | 8,8-dimethyl-2-methylsulfanyl-5-pyridin-1-ium-3-yl-5,5a,7,10-tetrahydro-3H-pyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CSc1nc2c(c(=O)[nH]1)C(c1ccc[nH+]c1)C1C(=O)CC(C)(C)C=C1N2 |
| InChI | InChI=1S/C19H20N4O2S/c1-19(2)7-11-14(12(24)8-19)13(10-5-4-6-20-9-10)15-16(21-11)22-18(26-3)23-17(15)25/h4-7,9,13-14H,8H2,1-3H3,(H2,21,22,23,25)/p+1 |
| InChIKey | LPKSFSVKSKXAFY-UHFFFAOYSA-O |
| XLogP | 2.36 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |