C26H33N3O5 — CID 3689712
5-(4-hexoxy-3-methoxyphenyl)-8,8-dimethyl-5,5a,7,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione (PubChem CID 3689712) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-(4-hexoxy-3-methoxyphenyl)-8,8-dimethyl-5,5a,7,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione.
| Compound Name | 5-(4-hexoxy-3-methoxyphenyl)-8,8-dimethyl-5,5a,7,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
|---|---|
| PubChem CID | 3689712 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | 5-(4-hexoxy-3-methoxyphenyl)-8,8-dimethyl-5,5a,7,10-tetrahydro-1H-pyrimido[4,5-b]quinoline-2,4,6-trione |
| SMILES | CCCCCCOc1ccc(C2c3c([nH]c(=O)[nH]c3=O)NC3=CC(C)(C)CC(=O)C32)cc1OC |
| InChI | InChI=1S/C26H33N3O5/c1-5-6-7-8-11-34-18-10-9-15(12-19(18)33-4)20-21-16(13-26(2,3)14-17(21)30)27-23-22(20)24(31)29-25(32)28-23/h9-10,12-13,20-21H,5-8,11,14H2,1-4H3,(H3,27,28,29,31,32) |
| InChIKey | QDLVUDHYVDQJBY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 113.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|