C36H72 — CID 90798988
(E)-4,7,11-tritert-butyl-2,6,9,13,15,16,16-heptamethylheptadec-6-ene (PubChem CID 90798988) has the molecular formula C36H72 and a molecular weight of 504.97 g/mol. Its IUPAC name is (E)-4,7,11-tritert-butyl-2,6,9,13,15,16,16-heptamethylheptadec-6-ene.
| Compound Name | (E)-4,7,11-tritert-butyl-2,6,9,13,15,16,16-heptamethylheptadec-6-ene |
|---|---|
| PubChem CID | 90798988 |
| Molecular Formula | C36H72 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.56 |
| IUPAC Name | (E)-4,7,11-tritert-butyl-2,6,9,13,15,16,16-heptamethylheptadec-6-ene |
| SMILES | C/C(CC(CC(C)C)C(C)(C)C)=C(/CC(C)CC(CC(C)CC(C)C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C36H72/c1-25(2)19-30(34(10,11)12)24-28(5)32(36(16,17)18)23-27(4)22-31(35(13,14)15)21-26(3)20-29(6)33(7,8)9/h25-27,29-31H,19-24H2,1-18H3/b32-28+ |
| InChIKey | GJXVJSKNBKCDHL-VEWQFJOQSA-N |
| XLogP | 12.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|