C7H10N2 — CID 90799466
4-methyl-3,4-dihydroazepin-2-imine (PubChem CID 90799466) has the molecular formula C7H10N2 and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-methyl-3,4-dihydroazepin-2-imine.
| Compound Name | 4-methyl-3,4-dihydroazepin-2-imine |
|---|---|
| PubChem CID | 90799466 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-methyl-3,4-dihydroazepin-2-imine |
| SMILES | [H]/N=C1/CC(C)C=CC=N1 |
| InChI | InChI=1S/C7H10N2/c1-6-3-2-4-9-7(8)5-6/h2-4,6,8H,5H2,1H3/b8-7- |
| InChIKey | MMCNRYIZOSBXRI-FPLPWBNLSA-N |
| XLogP | 1.63 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|