C13H26N2O4 — CID 90799473
N-[2-butoxy-5-hydroxy-6-(hydroxymethyl)-4-methylpiperidin-3-yl]acetamide (PubChem CID 90799473) has the molecular formula C13H26N2O4 and a molecular weight of 274.36 g/mol. Its IUPAC name is N-[2-butoxy-5-hydroxy-6-(hydroxymethyl)-4-methylpiperidin-3-yl]acetamide.
| Compound Name | N-[2-butoxy-5-hydroxy-6-(hydroxymethyl)-4-methylpiperidin-3-yl]acetamide |
|---|---|
| PubChem CID | 90799473 |
| Molecular Formula | C13H26N2O4 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | N-[2-butoxy-5-hydroxy-6-(hydroxymethyl)-4-methylpiperidin-3-yl]acetamide |
| SMILES | CCCCOC1NC(CO)C(O)C(C)C1NC(C)=O |
| InChI | InChI=1S/C13H26N2O4/c1-4-5-6-19-13-11(14-9(3)17)8(2)12(18)10(7-16)15-13/h8,10-13,15-16,18H,4-7H2,1-3H3,(H,14,17) |
| InChIKey | KLLLTKRXSKMSJJ-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|