C14H25NO6 — CID 163850772
N-[2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)-8-oxabicyclo[5.1.0]octan-3-yl]acetamide (PubChem CID 163850772) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is N-[2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)-8-oxabicyclo[5.1.0]octan-3-yl]acetamide.
| Compound Name | N-[2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)-8-oxabicyclo[5.1.0]octan-3-yl]acetamide |
|---|---|
| PubChem CID | 163850772 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | N-[2-butoxy-4,5-dihydroxy-6-(hydroxymethyl)-8-oxabicyclo[5.1.0]octan-3-yl]acetamide |
| SMILES | CCCCOC1C(NC(C)=O)C(O)C(O)C(CO)C2OC21 |
| InChI | InChI=1S/C14H25NO6/c1-3-4-5-20-13-9(15-7(2)17)11(19)10(18)8(6-16)12-14(13)21-12/h8-14,16,18-19H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | OUDSZPQARZPLCS-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|