C25H27NO3 — CID 90799778
(3-methyl-1-phenacyl-4H-isoquinolin-3-yl) cyclohexanecarboxylate (PubChem CID 90799778) has the molecular formula C25H27NO3 and a molecular weight of 389.50 g/mol. Its IUPAC name is (3-methyl-1-phenacyl-4H-isoquinolin-3-yl) cyclohexanecarboxylate.
| Compound Name | (3-methyl-1-phenacyl-4H-isoquinolin-3-yl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 90799778 |
| Molecular Formula | C25H27NO3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | (3-methyl-1-phenacyl-4H-isoquinolin-3-yl) cyclohexanecarboxylate |
| SMILES | CC1(OC(=O)C2CCCCC2)Cc2ccccc2C(CC(=O)c2ccccc2)=N1 |
| InChI | InChI=1S/C25H27NO3/c1-25(29-24(28)19-12-6-3-7-13-19)17-20-14-8-9-15-21(20)22(26-25)16-23(27)18-10-4-2-5-11-18/h2,4-5,8-11,14-15,19H,3,6-7,12-13,16-17H2,1H3 |
| InChIKey | IAXCZQHPEPNTJN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |