C17H21NO2 — CID 25209596
ethyl spiro[4H-isoquinoline-3,1'-cyclohexane]-1-carboxylate (PubChem CID 25209596) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is ethyl spiro[4H-isoquinoline-3,1'-cyclohexane]-1-carboxylate.
| Compound Name | ethyl spiro[4H-isoquinoline-3,1'-cyclohexane]-1-carboxylate |
|---|---|
| PubChem CID | 25209596 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | ethyl spiro[4H-isoquinoline-3,1'-cyclohexane]-1-carboxylate |
| SMILES | CCOC(=O)C1=NC2(CCCCC2)Cc2ccccc21 |
| InChI | InChI=1S/C17H21NO2/c1-2-20-16(19)15-14-9-5-4-8-13(14)12-17(18-15)10-6-3-7-11-17/h4-5,8-9H,2-3,6-7,10-12H2,1H3 |
| InChIKey | GNIDULUPTHGRJP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |