C20H20ClN3O2S — CID 90803027
O-[[3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate (PubChem CID 90803027) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is O-[[3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate.
| Compound Name | O-[[3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
|---|---|
| PubChem CID | 90803027 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | O-[[3-(4-chlorophenyl)-1-oxa-2,8-diazaspiro[4.5]dec-3-en-8-yl]] N-phenylcarbamothioate |
| SMILES | S=C(Nc1ccccc1)ON1CCC2(C=C(c3ccc(Cl)cc3)NO2)CC1 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-16-8-6-15(7-9-16)18-14-20(26-23-18)10-12-24(13-11-20)25-19(27)22-17-4-2-1-3-5-17/h1-9,14,23H,10-13H2,(H,22,27) |
| InChIKey | CPOXMKIWYSMRNT-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|