C15H13N5O3S2 — CID 90803728
5-[[3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazol-4-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 90803728) has the molecular formula C15H13N5O3S2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 5-[[3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazol-4-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazol-4-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 90803728 |
| Molecular Formula | C15H13N5O3S2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | 5-[[3-methyl-5-(4-methylthiadiazol-5-yl)-1,2-oxazol-4-yl]methylidene]-1-prop-2-enyl-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C=CCN1C(=O)C(=Cc2c(C)noc2-c2snnc2C)C(=O)NC1=S |
| InChI | InChI=1S/C15H13N5O3S2/c1-4-5-20-14(22)10(13(21)16-15(20)24)6-9-7(2)18-23-11(9)12-8(3)17-19-25-12/h4,6H,1,5H2,2-3H3,(H,16,21,24) |
| InChIKey | IONRXHVLINIUJN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|