C21H16N4O4S — CID 90804568
5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione (PubChem CID 90804568) has the molecular formula C21H16N4O4S and a molecular weight of 420.45 g/mol. Its IUPAC name is 5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90804568 |
| Molecular Formula | C21H16N4O4S |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | 5-[(1,6-dihydroxyisoindol-2-yl)methyl]-5-(5-pyridin-2-ylthiophen-2-yl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(Cn2cc3ccc(O)cc3c2O)(c2ccc(-c3ccccn3)s2)N1 |
| InChI | InChI=1S/C21H16N4O4S/c26-13-5-4-12-10-25(18(27)14(12)9-13)11-21(19(28)23-20(29)24-21)17-7-6-16(30-17)15-3-1-2-8-22-15/h1-10,26-27H,11H2,(H2,23,24,28,29) |
| InChIKey | SKQHACPWPUUSFT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|