C23H18FN3O3S — CID 90941501
(5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-methylthiophen-3-yl)phenyl]imidazolidine-2,4-dione (PubChem CID 90941501) has the molecular formula C23H18FN3O3S and a molecular weight of 435.48 g/mol. Its IUPAC name is (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-methylthiophen-3-yl)phenyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-methylthiophen-3-yl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90941501 |
| Molecular Formula | C23H18FN3O3S |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-[4-(4-methylthiophen-3-yl)phenyl]imidazolidine-2,4-dione |
| SMILES | Cc1cscc1-c1ccc([C@]2(Cn3cc4ccc(F)cc4c3O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C23H18FN3O3S/c1-13-10-31-11-19(13)14-2-5-16(6-3-14)23(21(29)25-22(30)26-23)12-27-9-15-4-7-17(24)8-18(15)20(27)28/h2-11,28H,12H2,1H3,(H2,25,26,29,30)/t23-/m0/s1 |
| InChIKey | KOVGIECBIMQSDZ-QHCPKHFHSA-N |
| XLogP | 4.26 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|