C22H16FN3O3S — CID 90803201
(5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(4-thiophen-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 90803201) has the molecular formula C22H16FN3O3S and a molecular weight of 421.45 g/mol. Its IUPAC name is (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(4-thiophen-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(4-thiophen-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 90803201 |
| Molecular Formula | C22H16FN3O3S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (5R)-5-[(6-fluoro-1-hydroxyisoindol-2-yl)methyl]-5-(4-thiophen-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@](Cn2cc3ccc(F)cc3c2O)(c2ccc(-c3cccs3)cc2)N1 |
| InChI | InChI=1S/C22H16FN3O3S/c23-16-8-5-14-11-26(19(27)17(14)10-16)12-22(20(28)24-21(29)25-22)15-6-3-13(4-7-15)18-2-1-9-30-18/h1-11,27H,12H2,(H2,24,25,28,29)/t22-/m0/s1 |
| InChIKey | SAYQFJBSTNAILY-QFIPXVFZSA-N |
| XLogP | 3.95 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|