C23H26ClN5 — CID 90805690
4-[(2-chlorophenyl)methyl]-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]piperazin-1-amine (PubChem CID 90805690) has the molecular formula C23H26ClN5 and a molecular weight of 407.95 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]piperazin-1-amine.
| Compound Name | 4-[(2-chlorophenyl)methyl]-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]piperazin-1-amine |
|---|---|
| PubChem CID | 90805690 |
| Molecular Formula | C23H26ClN5 |
| Molecular Weight | 407.95 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-2-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]piperazin-1-amine |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1C=C1CN(Cc2ccccc2Cl)CCN1N |
| InChI | InChI=1S/C23H26ClN5/c1-17-22(18(2)29(26-17)20-9-4-3-5-10-20)14-21-16-27(12-13-28(21)25)15-19-8-6-7-11-23(19)24/h3-11,14H,12-13,15-16,25H2,1-2H3 |
| InChIKey | JLJBRROYTMNVKC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.95 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|