C11H13N2O3P — CID 90805801
5-(2-amino-1-phosphanyloxyethyl)-8-hydroxy-1H-quinolin-2-one (PubChem CID 90805801) has the molecular formula C11H13N2O3P and a molecular weight of 252.21 g/mol. Its IUPAC name is 5-(2-amino-1-phosphanyloxyethyl)-8-hydroxy-1H-quinolin-2-one.
| Compound Name | 5-(2-amino-1-phosphanyloxyethyl)-8-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 90805801 |
| Molecular Formula | C11H13N2O3P |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 5-(2-amino-1-phosphanyloxyethyl)-8-hydroxy-1H-quinolin-2-one |
| SMILES | NCC(OP)c1ccc(O)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C11H13N2O3P/c12-5-9(16-17)6-1-3-8(14)11-7(6)2-4-10(15)13-11/h1-4,9,14H,5,12,17H2,(H,13,15) |
| InChIKey | HQSURESHLFCOSP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 88.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|