C21H28S — CID 90807804
3-ethenyl-2-(7-methylocta-1,3-dienyl)-4-prop-2-enylidene-5-propylidenethiophene (PubChem CID 90807804) has the molecular formula C21H28S and a molecular weight of 312.52 g/mol. Its IUPAC name is 3-ethenyl-2-(7-methylocta-1,3-dienyl)-4-prop-2-enylidene-5-propylidenethiophene.
| Compound Name | 3-ethenyl-2-(7-methylocta-1,3-dienyl)-4-prop-2-enylidene-5-propylidenethiophene |
|---|---|
| PubChem CID | 90807804 |
| Molecular Formula | C21H28S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 3-ethenyl-2-(7-methylocta-1,3-dienyl)-4-prop-2-enylidene-5-propylidenethiophene |
| SMILES | C=CC=c1c(C=C)c(C=CC=CCCC(C)C)sc1=CCC |
| InChI | InChI=1S/C21H28S/c1-6-13-19-18(8-3)21(22-20(19)14-7-2)16-12-10-9-11-15-17(4)5/h6,8-10,12-14,16-17H,1,3,7,11,15H2,2,4-5H3 |
| InChIKey | IXDIAXFPMUFZIX-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|