C24H27N3O — CID 90810331
5-ethyl-2-[4-[3-(4-methylphenyl)phenoxy]piperidin-1-yl]pyrimidine (PubChem CID 90810331) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is 5-ethyl-2-[4-[3-(4-methylphenyl)phenoxy]piperidin-1-yl]pyrimidine.
| Compound Name | 5-ethyl-2-[4-[3-(4-methylphenyl)phenoxy]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 90810331 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 5-ethyl-2-[4-[3-(4-methylphenyl)phenoxy]piperidin-1-yl]pyrimidine |
| SMILES | CCc1cnc(N2CCC(Oc3cccc(-c4ccc(C)cc4)c3)CC2)nc1 |
| InChI | InChI=1S/C24H27N3O/c1-3-19-16-25-24(26-17-19)27-13-11-22(12-14-27)28-23-6-4-5-21(15-23)20-9-7-18(2)8-10-20/h4-10,15-17,22H,3,11-14H2,1-2H3 |
| InChIKey | SKHLODDQEUQDDX-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |